C38H32F4IrN2S-2 — CID 169301228
2-(4-fluorobenzene-6-id-1-yl)-4,5-bis(trideuteriomethyl)pyridine;iridium;3-methyl-7-phenyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine (PubChem CID 169301228) has the molecular formula C38H32F4IrN2S-2 and a molecular weight of 823.00 g/mol. Its IUPAC name is 2-(4-fluorobenzene-6-id-1-yl)-4,5-bis(trideuteriomethyl)pyridine;iridium;3-methyl-7-phenyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine.
| Compound Name | 2-(4-fluorobenzene-6-id-1-yl)-4,5-bis(trideuteriomethyl)pyridine;iridium;3-methyl-7-phenyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 169301228 |
| Molecular Formula | C38H32F4IrN2S-2 |
| Molecular Weight | 823.00 g/mol |
| Exact Mass | 823.22 |
| IUPAC Name | 2-(4-fluorobenzene-6-id-1-yl)-4,5-bis(trideuteriomethyl)pyridine;iridium;3-methyl-7-phenyl-2-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]thieno[2,3-c]pyridine |
| SMILES | Cc1c(-c2ccc(CC(C)(C)C(F)(F)F)cc2)sc2c(-c3[c-]cccc3)nccc12.[2H]C([2H])([2H])c1cnc(-c2[c-]cc(F)cc2)cc1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C25H21F3NS.C13H11FN.Ir/c1-16-20-13-14-29-21(18-7-5-4-6-8-18)23(20)30-22(16)19-11-9-17(10-12-19)15-24(2,3)25(26,27)28;1-9-7-13(15-8-10(9)2)11-3-5-12(14)6-4-11;/h4-7,9-14H,15H2,1-3H3;3,5-8H,1-2H3;/q2*-1;/i;1D3,2D3; |
| InChIKey | OTPXONSLIBXAPJ-RUHQGNAASA-N |
| XLogP | 11.17 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.00 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|