C64H42N6OPt — CID 169301900
CID 169301900 (PubChem CID 169301900) has the molecular formula C64H42N6OPt and a molecular weight of 1106.16 g/mol.
| Compound Name | CID 169301900 |
|---|---|
| PubChem CID | 169301900 |
| Molecular Formula | C64H42N6OPt |
| Molecular Weight | 1106.16 g/mol |
| Exact Mass | 1105.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(-n4c5[c-]c(-c6nc7ccccc7n6-c6ccccc6)c6oc7cc(-n8c9ccccc9c9ccccc98)ccc7c6c5c5ccccc54)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C64H42N6O.Pt/c1-64(2,3)39-33-34-65-59(35-39)70-53-26-14-9-21-45(53)46-31-29-41(36-56(46)70)68-54-27-15-10-22-47(54)60-57(68)38-49(63-66-50-23-11-16-28-55(50)69(63)40-17-5-4-6-18-40)62-61(60)48-32-30-42(37-58(48)71-62)67-51-24-12-7-19-43(51)44-20-8-13-25-52(44)67;/h4-35,37H,1-3H3;/q-2;+2 |
| InChIKey | RNIAEFJCPYSYOK-UHFFFAOYSA-N |
| XLogP | 16.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1106.16 |
| LogP ≤ 5 | 16.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|