C27H35N3O3S — CID 169302364
6-[2-(3-tert-butyl-2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylhexyl (E)-but-2-enoate (PubChem CID 169302364) has the molecular formula C27H35N3O3S and a molecular weight of 481.66 g/mol. Its IUPAC name is 6-[2-(3-tert-butyl-2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylhexyl (E)-but-2-enoate.
| Compound Name | 6-[2-(3-tert-butyl-2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylhexyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 169302364 |
| Molecular Formula | C27H35N3O3S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 6-[2-(3-tert-butyl-2-hydroxy-5-methylphenyl)benzotriazol-5-yl]sulfanylhexyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCCCCCCSc1ccc2nn(-c3cc(C)cc(C(C)(C)C)c3O)nc2c1 |
| InChI | InChI=1S/C27H35N3O3S/c1-6-11-25(31)33-14-9-7-8-10-15-34-20-12-13-22-23(18-20)29-30(28-22)24-17-19(2)16-21(26(24)32)27(3,4)5/h6,11-13,16-18,32H,7-10,14-15H2,1-5H3/b11-6+ |
| InChIKey | VTBNFIQCTDTDKO-IZZDOVSWSA-N |
| XLogP | 6.50 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|