C5H4F2N2O — CID 169305039
(4,6-difluoro-3-pyridinyl)-oxidoazanium (PubChem CID 169305039) has the molecular formula C5H4F2N2O and a molecular weight of 146.10 g/mol. Its IUPAC name is (4,6-difluoro-3-pyridinyl)-oxidoazanium.
| Compound Name | (4,6-difluoro-3-pyridinyl)-oxidoazanium |
|---|---|
| PubChem CID | 169305039 |
| Molecular Formula | C5H4F2N2O |
| Molecular Weight | 146.10 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | (4,6-difluoro-3-pyridinyl)-oxidoazanium |
| SMILES | [O-][NH2+]c1cnc(F)cc1F |
| InChI | InChI=1S/C5H4F2N2O/c6-3-1-5(7)8-2-4(3)9-10/h1-2H,9H2 |
| InChIKey | JRRPFOMOONZJLQ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 52.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.10 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|