C5H3F2N2O- — CID 169305040
4,6-difluoro-N-oxidopyridin-3-amine (PubChem CID 169305040) has the molecular formula C5H3F2N2O- and a molecular weight of 145.09 g/mol. Its IUPAC name is 4,6-difluoro-N-oxidopyridin-3-amine.
| Compound Name | 4,6-difluoro-N-oxidopyridin-3-amine |
|---|---|
| PubChem CID | 169305040 |
| Molecular Formula | C5H3F2N2O- |
| Molecular Weight | 145.09 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 4,6-difluoro-N-oxidopyridin-3-amine |
| SMILES | [O-]Nc1cnc(F)cc1F |
| InChI | InChI=1S/C5H3F2N2O/c6-3-1-5(7)8-2-4(3)9-10/h1-2,9H/q-1 |
| InChIKey | HQUHJMIMLPLNPE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 47.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.09 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|