C12H24F2 — CID 169306156
4,4-difluoro-2,2,7,7-tetramethyloctane (PubChem CID 169306156) has the molecular formula C12H24F2 and a molecular weight of 206.32 g/mol. Its IUPAC name is 4,4-difluoro-2,2,7,7-tetramethyloctane.
| Compound Name | 4,4-difluoro-2,2,7,7-tetramethyloctane |
|---|---|
| PubChem CID | 169306156 |
| Molecular Formula | C12H24F2 |
| Molecular Weight | 206.32 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 4,4-difluoro-2,2,7,7-tetramethyloctane |
| SMILES | CC(C)(C)CCC(F)(F)CC(C)(C)C |
| InChI | InChI=1S/C12H24F2/c1-10(2,3)7-8-12(13,14)9-11(4,5)6/h7-9H2,1-6H3 |
| InChIKey | KVGRKXIIORXGOA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |