C15H23N5O5 — CID 169308783
2-amino-9-[(2R,3R,4S,5S)-3-hydroxy-5-(hydroxymethyl)-4-(2-propoxyethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 169308783) has the molecular formula C15H23N5O5 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5S)-3-hydroxy-5-(hydroxymethyl)-4-(2-propoxyethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5S)-3-hydroxy-5-(hydroxymethyl)-4-(2-propoxyethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 169308783 |
| Molecular Formula | C15H23N5O5 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5S)-3-hydroxy-5-(hydroxymethyl)-4-(2-propoxyethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CCCOCC[C@H]1[C@@H](O)[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1CO |
| InChI | InChI=1S/C15H23N5O5/c1-2-4-24-5-3-8-9(6-21)25-14(11(8)22)20-7-17-10-12(20)18-15(16)19-13(10)23/h7-9,11,14,21-22H,2-6H2,1H3,(H3,16,18,19,23)/t8-,9-,11-,14-/m1/s1 |
| InChIKey | MIOHZHVHIBTKCZ-RSVSFAPFSA-N |
| XLogP | -0.61 |
| TPSA | 148.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|