C44H31N4O2Pt- — CID 169318038
2-[4-phenyl-6-[2-(3-phenyl-7-propan-2-ylimidazo[1,2-a]pyrimidin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum (PubChem CID 169318038) has the molecular formula C44H31N4O2Pt- and a molecular weight of 842.84 g/mol. Its IUPAC name is 2-[4-phenyl-6-[2-(3-phenyl-7-propan-2-ylimidazo[1,2-a]pyrimidin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-phenyl-6-[2-(3-phenyl-7-propan-2-ylimidazo[1,2-a]pyrimidin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 169318038 |
| Molecular Formula | C44H31N4O2Pt- |
| Molecular Weight | 842.84 g/mol |
| Exact Mass | 842.21 |
| IUPAC Name | 2-[4-phenyl-6-[2-(3-phenyl-7-propan-2-ylimidazo[1,2-a]pyrimidin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)c1ccn2c(-c3ccccc3)c(-c3[c-]c(-c4cc(-c5ccccc5)cc(-c5ccccc5O)n4)c4oc5ccccc5c4c3)nc2n1.[Pt] |
| InChI | InChI=1S/C44H31N4O2.Pt/c1-27(2)36-21-22-48-42(29-15-7-4-8-16-29)41(47-44(48)46-36)31-23-34-32-17-10-12-20-40(32)50-43(34)35(24-31)38-26-30(28-13-5-3-6-14-28)25-37(45-38)33-18-9-11-19-39(33)49;/h3-23,25-27,49H,1-2H3;/q-1; |
| InChIKey | XCOJHYJCNNULFO-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.84 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|