C46H28N3O2Pt- — CID 169318153
2-[4-phenyl-6-[2-(3-phenylimidazo[2,1-a]isoquinolin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum (PubChem CID 169318153) has the molecular formula C46H28N3O2Pt- and a molecular weight of 849.83 g/mol. Its IUPAC name is 2-[4-phenyl-6-[2-(3-phenylimidazo[2,1-a]isoquinolin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-phenyl-6-[2-(3-phenylimidazo[2,1-a]isoquinolin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 169318153 |
| Molecular Formula | C46H28N3O2Pt- |
| Molecular Weight | 849.83 g/mol |
| Exact Mass | 849.18 |
| IUPAC Name | 2-[4-phenyl-6-[2-(3-phenylimidazo[2,1-a]isoquinolin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum |
| SMILES | Oc1ccccc1-c1cc(-c2ccccc2)cc(-c2[c-]c(-c3nc4c5ccccc5ccn4c3-c3ccccc3)cc3c2oc2ccccc23)n1.[Pt] |
| InChI | InChI=1S/C46H28N3O2.Pt/c50-41-21-11-9-20-36(41)39-27-32(29-13-3-1-4-14-29)28-40(47-39)38-26-33(25-37-35-19-10-12-22-42(35)51-45(37)38)43-44(31-16-5-2-6-17-31)49-24-23-30-15-7-8-18-34(30)46(49)48-43;/h1-25,27-28,50H;/q-1; |
| InChIKey | GENHDDUNJMNZHH-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 63.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.83 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|