C47H30N3O2Pt- — CID 169318232
2-[4-(2-methylphenyl)-6-[2-(3-phenylimidazo[2,1-a]isoquinolin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum (PubChem CID 169318232) has the molecular formula C47H30N3O2Pt- and a molecular weight of 863.85 g/mol. Its IUPAC name is 2-[4-(2-methylphenyl)-6-[2-(3-phenylimidazo[2,1-a]isoquinolin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-(2-methylphenyl)-6-[2-(3-phenylimidazo[2,1-a]isoquinolin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 169318232 |
| Molecular Formula | C47H30N3O2Pt- |
| Molecular Weight | 863.85 g/mol |
| Exact Mass | 863.20 |
| IUPAC Name | 2-[4-(2-methylphenyl)-6-[2-(3-phenylimidazo[2,1-a]isoquinolin-2-yl)-3H-dibenzofuran-3-id-4-yl]-2-pyridinyl]phenol;platinum |
| SMILES | Cc1ccccc1-c1cc(-c2ccccc2O)nc(-c2[c-]c(-c3nc4c5ccccc5ccn4c3-c3ccccc3)cc3c2oc2ccccc23)c1.[Pt] |
| InChI | InChI=1S/C47H30N3O2.Pt/c1-29-13-5-7-17-34(29)32-27-40(37-20-9-11-21-42(37)51)48-41(28-32)39-26-33(25-38-36-19-10-12-22-43(36)52-46(38)39)44-45(31-15-3-2-4-16-31)50-24-23-30-14-6-8-18-35(30)47(50)49-44;/h2-25,27-28,51H,1H3;/q-1; |
| InChIKey | CHAPFBCYESCSMS-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 63.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.85 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|