About [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone
[(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone (PubChem CID 169318560) has the molecular formula C10H17N3OS2
and a molecular weight of 259.40 g/mol. Its IUPAC name is [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone |
| PubChem CID | 169318560 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1CSC2(CNC2)N1)N1CCSCC1 |
| InChI | InChI=1S/C10H17N3OS2/c14-9(13-1-3-15-4-2-13)8-5-16-10(12-8)6-11-7-10/h8,11-12H,1-7H2/t8-/m0/s1 |
| InChIKey | PNGTUKIDAHAEBG-QMMMGPOBSA-N |
| XLogP | -0.43 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone?
The IUPAC name of [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone (CID 169318560) is [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone.
What is the SMILES notation for [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone?
The canonical SMILES for [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone is O=C([C@@H]1CSC2(CNC2)N1)N1CCSCC1.
What is the InChIKey of [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone?
The InChIKey is PNGTUKIDAHAEBG-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H17N3OS2/c14-9(13-1-3-15-4-2-13)8-5-16-10(12-8)6-11-7-10/h8,11-12H,1-7H2/t8-/m0/s1.
What are the key properties of [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone?
[(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone has a molecular weight of 259.40 g/mol, XLogP of -0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(7R)-5-thia-2,8-diazaspiro[3.4]octan-7-yl]-thiomorpholin-4-ylmethanone is sourced from PubChem (CID 169318560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).