C7H13N3OS — CID 169318375
(3R)-1-thia-4,7-diazaspiro[4.4]nonane-3-carboxamide (PubChem CID 169318375) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is (3R)-1-thia-4,7-diazaspiro[4.4]nonane-3-carboxamide.
| Compound Name | (3R)-1-thia-4,7-diazaspiro[4.4]nonane-3-carboxamide |
|---|---|
| PubChem CID | 169318375 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (3R)-1-thia-4,7-diazaspiro[4.4]nonane-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CSC2(CCNC2)N1 |
| InChI | InChI=1S/C7H13N3OS/c8-6(11)5-3-12-7(10-5)1-2-9-4-7/h5,9-10H,1-4H2,(H2,8,11)/t5-,7?/m0/s1 |
| InChIKey | SXSAEICBCGBCNH-DSEUIKHZSA-N |
| XLogP | -1.13 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |