C8H13N3O2S — CID 169318602
(7R)-2-acetyl-5-thia-2,8-diazaspiro[3.4]octane-7-carboxamide (PubChem CID 169318602) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is (7R)-2-acetyl-5-thia-2,8-diazaspiro[3.4]octane-7-carboxamide.
| Compound Name | (7R)-2-acetyl-5-thia-2,8-diazaspiro[3.4]octane-7-carboxamide |
|---|---|
| PubChem CID | 169318602 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (7R)-2-acetyl-5-thia-2,8-diazaspiro[3.4]octane-7-carboxamide |
| SMILES | CC(=O)N1CC2(C1)N[C@H](C(N)=O)CS2 |
| InChI | InChI=1S/C8H13N3O2S/c1-5(12)11-3-8(4-11)10-6(2-14-8)7(9)13/h6,10H,2-4H2,1H3,(H2,9,13)/t6-/m0/s1 |
| InChIKey | CPPCSNMGFJSPQR-LURJTMIESA-N |
| XLogP | -1.26 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |