C18H18Cl2O4 — CID 169318833
2-[3,5-dichloro-4-[[2,6-dideuterio-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-hydroxyphenyl]methyl]phenoxy]acetic acid (PubChem CID 169318833) has the molecular formula C18H18Cl2O4 and a molecular weight of 378.30 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[2,6-dideuterio-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-hydroxyphenyl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3,5-dichloro-4-[[2,6-dideuterio-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-hydroxyphenyl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 169318833 |
| Molecular Formula | C18H18Cl2O4 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-[3,5-dichloro-4-[[2,6-dideuterio-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-hydroxyphenyl]methyl]phenoxy]acetic acid |
| SMILES | [2H]c1cc(O)c(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c([2H])c1Cc1c(Cl)cc(OCC(=O)O)cc1Cl |
| InChI | InChI=1S/C18H18Cl2O4/c1-10(2)13-5-11(3-4-17(13)21)6-14-15(19)7-12(8-16(14)20)24-9-18(22)23/h3-5,7-8,10,21H,6,9H2,1-2H3,(H,22,23)/i1D3,2D3,3D,5D,10D |
| InChIKey | DRXFTZNITLYKQA-SFXLROAJSA-N |
| XLogP | 4.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |