C11H15NO2 — CID 169319913
N-(2-hydroxyethyl)nona-6,8-diynamide (PubChem CID 169319913) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-(2-hydroxyethyl)nona-6,8-diynamide.
| Compound Name | N-(2-hydroxyethyl)nona-6,8-diynamide |
|---|---|
| PubChem CID | 169319913 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-(2-hydroxyethyl)nona-6,8-diynamide |
| SMILES | C#CC#CCCCCC(=O)NCCO |
| InChI | InChI=1S/C11H15NO2/c1-2-3-4-5-6-7-8-11(14)12-9-10-13/h1,13H,5-10H2,(H,12,14) |
| InChIKey | TUOKGQXCEFQWNX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|