C30H26N6O3S — CID 169320788
4-methoxy-6-[1-(oxan-2-yl)indazol-4-yl]-2-phenoxy-8-(1,3-thiazol-2-yl)quinazolin-5-amine (PubChem CID 169320788) has the molecular formula C30H26N6O3S and a molecular weight of 550.64 g/mol. Its IUPAC name is 4-methoxy-6-[1-(oxan-2-yl)indazol-4-yl]-2-phenoxy-8-(1,3-thiazol-2-yl)quinazolin-5-amine.
| Compound Name | 4-methoxy-6-[1-(oxan-2-yl)indazol-4-yl]-2-phenoxy-8-(1,3-thiazol-2-yl)quinazolin-5-amine |
|---|---|
| PubChem CID | 169320788 |
| Molecular Formula | C30H26N6O3S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | 4-methoxy-6-[1-(oxan-2-yl)indazol-4-yl]-2-phenoxy-8-(1,3-thiazol-2-yl)quinazolin-5-amine |
| SMILES | COc1nc(Oc2ccccc2)nc2c(-c3nccs3)cc(-c3cccc4c3cnn4C3CCCCO3)c(N)c12 |
| InChI | InChI=1S/C30H26N6O3S/c1-37-28-25-26(31)20(19-10-7-11-23-22(19)17-33-36(23)24-12-5-6-14-38-24)16-21(29-32-13-15-40-29)27(25)34-30(35-28)39-18-8-3-2-4-9-18/h2-4,7-11,13,15-17,24H,5-6,12,14,31H2,1H3 |
| InChIKey | PNBWNTATMJREPA-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|