C10H10N4O2S2 — CID 169326067
6-azido-2-propan-2-ylsulfonyl-1,3-benzothiazole (PubChem CID 169326067) has the molecular formula C10H10N4O2S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 6-azido-2-propan-2-ylsulfonyl-1,3-benzothiazole.
| Compound Name | 6-azido-2-propan-2-ylsulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 169326067 |
| Molecular Formula | C10H10N4O2S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 6-azido-2-propan-2-ylsulfonyl-1,3-benzothiazole |
| SMILES | CC(C)S(=O)(=O)c1nc2ccc(N=[N+]=[N-])cc2s1 |
| InChI | InChI=1S/C10H10N4O2S2/c1-6(2)18(15,16)10-12-8-4-3-7(13-14-11)5-9(8)17-10/h3-6H,1-2H3 |
| InChIKey | IBIOHPRMNGRCTQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|