C19H21N5O6S — CID 169327247
4-amino-5-[4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169327247) has the molecular formula C19H21N5O6S and a molecular weight of 447.47 g/mol. Its IUPAC name is 4-amino-5-[4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169327247 |
| Molecular Formula | C19H21N5O6S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-amino-5-[4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylphenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1ccc(S(=O)(=O)N3CCN(CCO)CC3)cc1)C(=O)NC2=O |
| InChI | InChI=1S/C19H21N5O6S/c20-17-16-14(18(27)21-19(16)28)11-15(26)24(17)12-1-3-13(4-2-12)31(29,30)23-7-5-22(6-8-23)9-10-25/h1-4,11,25H,5-10,20H2,(H,21,27,28) |
| InChIKey | PDMIVULVOSWYQC-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|