C18H17F3N4O3 — CID 169328885
4-amino-5-[2-(diethylamino)-5-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169328885) has the molecular formula C18H17F3N4O3 and a molecular weight of 394.35 g/mol. Its IUPAC name is 4-amino-5-[2-(diethylamino)-5-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[2-(diethylamino)-5-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169328885 |
| Molecular Formula | C18H17F3N4O3 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 4-amino-5-[2-(diethylamino)-5-(trifluoromethyl)phenyl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | CCN(CC)c1ccc(C(F)(F)F)cc1-n1c(N)c2c(cc1=O)C(=O)NC2=O |
| InChI | InChI=1S/C18H17F3N4O3/c1-3-24(4-2)11-6-5-9(18(19,20)21)7-12(11)25-13(26)8-10-14(15(25)22)17(28)23-16(10)27/h5-8H,3-4,22H2,1-2H3,(H,23,27,28) |
| InChIKey | SZTVBQFLLYKIIY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|