C20H10F3N3O5 — CID 169330571
4-amino-5-[3-(trifluoromethyl)dibenzo-p-dioxin-1-yl]pyrrolo[3,4-c]pyridine-1,3,6-trione (PubChem CID 169330571) has the molecular formula C20H10F3N3O5 and a molecular weight of 429.31 g/mol. Its IUPAC name is 4-amino-5-[3-(trifluoromethyl)dibenzo-p-dioxin-1-yl]pyrrolo[3,4-c]pyridine-1,3,6-trione.
| Compound Name | 4-amino-5-[3-(trifluoromethyl)dibenzo-p-dioxin-1-yl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 169330571 |
| Molecular Formula | C20H10F3N3O5 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 4-amino-5-[3-(trifluoromethyl)dibenzo-p-dioxin-1-yl]pyrrolo[3,4-c]pyridine-1,3,6-trione |
| SMILES | Nc1c2c(cc(=O)n1-c1cc(C(F)(F)F)cc3c1Oc1ccccc1O3)C(=O)NC2=O |
| InChI | InChI=1S/C20H10F3N3O5/c21-20(22,23)8-5-10(16-13(6-8)30-11-3-1-2-4-12(11)31-16)26-14(27)7-9-15(17(26)24)19(29)25-18(9)28/h1-7H,24H2,(H,25,28,29) |
| InChIKey | HMKMAFSJOGCADP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|