C16H13NO3S — CID 169333063
5-(5-formylfuran-2-yl)-N,N-dimethyl-1-benzothiophene-2-carboxamide (PubChem CID 169333063) has the molecular formula C16H13NO3S and a molecular weight of 299.35 g/mol. Its IUPAC name is 5-(5-formylfuran-2-yl)-N,N-dimethyl-1-benzothiophene-2-carboxamide.
| Compound Name | 5-(5-formylfuran-2-yl)-N,N-dimethyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 169333063 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 5-(5-formylfuran-2-yl)-N,N-dimethyl-1-benzothiophene-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cc(-c3ccc(C=O)o3)ccc2s1 |
| InChI | InChI=1S/C16H13NO3S/c1-17(2)16(19)15-8-11-7-10(3-6-14(11)21-15)13-5-4-12(9-18)20-13/h3-9H,1-2H3 |
| InChIKey | JGAWHQKENNMJEL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|