C17H17NO4 — CID 169333386
2-(5-formylfuran-2-yl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 169333386) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-(5-formylfuran-2-yl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-(5-formylfuran-2-yl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 169333386 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-(5-formylfuran-2-yl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=Cc1ccc(-c2ccccc2C(=O)NCC2CCCO2)o1 |
| InChI | InChI=1S/C17H17NO4/c19-11-13-7-8-16(22-13)14-5-1-2-6-15(14)17(20)18-10-12-4-3-9-21-12/h1-2,5-8,11-12H,3-4,9-10H2,(H,18,20) |
| InChIKey | ZERFECHECQHFEL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|