C14H12FNO5 — CID 169335091
3-fluoro-2-(5-formylfuran-2-yl)-4,5-dimethoxybenzamide (PubChem CID 169335091) has the molecular formula C14H12FNO5 and a molecular weight of 293.25 g/mol. Its IUPAC name is 3-fluoro-2-(5-formylfuran-2-yl)-4,5-dimethoxybenzamide.
| Compound Name | 3-fluoro-2-(5-formylfuran-2-yl)-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 169335091 |
| Molecular Formula | C14H12FNO5 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-fluoro-2-(5-formylfuran-2-yl)-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(N)=O)c(-c2ccc(C=O)o2)c(F)c1OC |
| InChI | InChI=1S/C14H12FNO5/c1-19-10-5-8(14(16)18)11(12(15)13(10)20-2)9-4-3-7(6-17)21-9/h3-6H,1-2H3,(H2,16,18) |
| InChIKey | HOCBQQIMXKZKIP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|