About 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile
2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169340210) has the molecular formula C16H11N7
and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile |
| PubChem CID | 169340210 |
| Molecular Formula | C16H11N7 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | Cc1ccn2cc(-c3ccc(NN=C(C#N)C#N)cc3)nc2n1 |
| InChI | InChI=1S/C16H11N7/c1-11-6-7-23-10-15(20-16(23)19-11)12-2-4-13(5-3-12)21-22-14(8-17)9-18/h2-7,10,21H,1H3 |
| InChIKey | UGHHTEZQDHTFAR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile?
The IUPAC name of 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile (CID 169340210) is 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile.
What is the SMILES notation for 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile?
The canonical SMILES for 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile is Cc1ccn2cc(-c3ccc(NN=C(C#N)C#N)cc3)nc2n1.
What is the InChIKey of 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile?
The InChIKey is UGHHTEZQDHTFAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N7/c1-11-6-7-23-10-15(20-16(23)19-11)12-2-4-13(5-3-12)21-22-14(8-17)9-18/h2-7,10,21H,1H3.
What are the key properties of 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile?
2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile has a molecular weight of 301.31 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(7-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]hydrazinylidene]propanedinitrile is sourced from PubChem (CID 169340210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).