C8H4Br2ClNO — CID 169352191
1,5-dibromo-2-chloro-4-isocyanato-3-methylbenzene (PubChem CID 169352191) has the molecular formula C8H4Br2ClNO and a molecular weight of 325.39 g/mol. Its IUPAC name is 1,5-dibromo-2-chloro-4-isocyanato-3-methylbenzene.
| Compound Name | 1,5-dibromo-2-chloro-4-isocyanato-3-methylbenzene |
|---|---|
| PubChem CID | 169352191 |
| Molecular Formula | C8H4Br2ClNO |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 322.83 |
| IUPAC Name | 1,5-dibromo-2-chloro-4-isocyanato-3-methylbenzene |
| SMILES | Cc1c(Cl)c(Br)cc(Br)c1N=C=O |
| InChI | InChI=1S/C8H4Br2ClNO/c1-4-7(11)5(9)2-6(10)8(4)12-3-13/h2H,1H3 |
| InChIKey | RWHYTMXYKPHHMU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|