C14H8N2OS — CID 169353182
2-(3-isocyanatophenyl)-1,3-benzothiazole (PubChem CID 169353182) has the molecular formula C14H8N2OS and a molecular weight of 252.30 g/mol. Its IUPAC name is 2-(3-isocyanatophenyl)-1,3-benzothiazole.
| Compound Name | 2-(3-isocyanatophenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 169353182 |
| Molecular Formula | C14H8N2OS |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 2-(3-isocyanatophenyl)-1,3-benzothiazole |
| SMILES | O=C=Nc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C14H8N2OS/c17-9-15-11-5-3-4-10(8-11)14-16-12-6-1-2-7-13(12)18-14/h1-8H |
| InChIKey | VJLMUVJCKJGGBT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|