C25H33N3O3S — CID 16935358
2-[3-(benzenesulfonyl)indol-1-yl]-N-[5-(diethylamino)pentan-2-yl]acetamide (PubChem CID 16935358) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)indol-1-yl]-N-[5-(diethylamino)pentan-2-yl]acetamide.
| Compound Name | 2-[3-(benzenesulfonyl)indol-1-yl]-N-[5-(diethylamino)pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 16935358 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[3-(benzenesulfonyl)indol-1-yl]-N-[5-(diethylamino)pentan-2-yl]acetamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)Cn1cc(S(=O)(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H33N3O3S/c1-4-27(5-2)17-11-12-20(3)26-25(29)19-28-18-24(22-15-9-10-16-23(22)28)32(30,31)21-13-7-6-8-14-21/h6-10,13-16,18,20H,4-5,11-12,17,19H2,1-3H3,(H,26,29) |
| InChIKey | IYKYSKAMJDGZKD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |