C29H23ClN2O3S — CID 30554059
N-benzhydryl-2-[3-(4-chlorophenyl)sulfonylindol-1-yl]acetamide (PubChem CID 30554059) has the molecular formula C29H23ClN2O3S and a molecular weight of 515.03 g/mol. Its IUPAC name is N-benzhydryl-2-[3-(4-chlorophenyl)sulfonylindol-1-yl]acetamide.
| Compound Name | N-benzhydryl-2-[3-(4-chlorophenyl)sulfonylindol-1-yl]acetamide |
|---|---|
| PubChem CID | 30554059 |
| Molecular Formula | C29H23ClN2O3S |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | N-benzhydryl-2-[3-(4-chlorophenyl)sulfonylindol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)c2ccc(Cl)cc2)c2ccccc21)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H23ClN2O3S/c30-23-15-17-24(18-16-23)36(34,35)27-19-32(26-14-8-7-13-25(26)27)20-28(33)31-29(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-19,29H,20H2,(H,31,33) |
| InChIKey | RMAWVWIIPPEIAV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |