C11H10N2OS2 — CID 169354538
6-isocyanato-2-propan-2-ylsulfanyl-1,3-benzothiazole (PubChem CID 169354538) has the molecular formula C11H10N2OS2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 6-isocyanato-2-propan-2-ylsulfanyl-1,3-benzothiazole.
| Compound Name | 6-isocyanato-2-propan-2-ylsulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 169354538 |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 6-isocyanato-2-propan-2-ylsulfanyl-1,3-benzothiazole |
| SMILES | CC(C)Sc1nc2ccc(N=C=O)cc2s1 |
| InChI | InChI=1S/C11H10N2OS2/c1-7(2)15-11-13-9-4-3-8(12-6-14)5-10(9)16-11/h3-5,7H,1-2H3 |
| InChIKey | VHIOGDYHWPCFJJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|