C27H19IN2S2 — CID 98109611
N-(2-benzhydrylsulfanyl-1,3-benzothiazol-6-yl)-1-(4-iodophenyl)methanimine (PubChem CID 98109611) has the molecular formula C27H19IN2S2 and a molecular weight of 562.50 g/mol. Its IUPAC name is N-(2-benzhydrylsulfanyl-1,3-benzothiazol-6-yl)-1-(4-iodophenyl)methanimine.
| Compound Name | N-(2-benzhydrylsulfanyl-1,3-benzothiazol-6-yl)-1-(4-iodophenyl)methanimine |
|---|---|
| PubChem CID | 98109611 |
| Molecular Formula | C27H19IN2S2 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.00 |
| IUPAC Name | N-(2-benzhydrylsulfanyl-1,3-benzothiazol-6-yl)-1-(4-iodophenyl)methanimine |
| SMILES | Ic1ccc(/C=N/c2ccc3nc(SC(c4ccccc4)c4ccccc4)sc3c2)cc1 |
| InChI | InChI=1S/C27H19IN2S2/c28-22-13-11-19(12-14-22)18-29-23-15-16-24-25(17-23)31-27(30-24)32-26(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-18,26H/b29-18+ |
| InChIKey | QJSUDXVNLARYJD-RDRPBHBLSA-N |
| XLogP | 8.53 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|