C12H14N2OS — CID 169356155
(5-oxo-6,7,8,9-tetrahydrobenzo[7]annulen-1-yl)thiourea (PubChem CID 169356155) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is (5-oxo-6,7,8,9-tetrahydrobenzo[7]annulen-1-yl)thiourea.
| Compound Name | (5-oxo-6,7,8,9-tetrahydrobenzo[7]annulen-1-yl)thiourea |
|---|---|
| PubChem CID | 169356155 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (5-oxo-6,7,8,9-tetrahydrobenzo[7]annulen-1-yl)thiourea |
| SMILES | NC(=S)Nc1cccc2c1CCCCC2=O |
| InChI | InChI=1S/C12H14N2OS/c13-12(16)14-10-6-3-5-9-8(10)4-1-2-7-11(9)15/h3,5-6H,1-2,4,7H2,(H3,13,14,16) |
| InChIKey | DXJDNGARXGYKAL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|