C7H5BrCl2N2S — CID 169359605
(3-bromo-2,4-dichlorophenyl)thiourea (PubChem CID 169359605) has the molecular formula C7H5BrCl2N2S and a molecular weight of 300.01 g/mol. Its IUPAC name is (3-bromo-2,4-dichlorophenyl)thiourea.
| Compound Name | (3-bromo-2,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 169359605 |
| Molecular Formula | C7H5BrCl2N2S |
| Molecular Weight | 300.01 g/mol |
| Exact Mass | 297.87 |
| IUPAC Name | (3-bromo-2,4-dichlorophenyl)thiourea |
| SMILES | NC(=S)Nc1ccc(Cl)c(Br)c1Cl |
| InChI | InChI=1S/C7H5BrCl2N2S/c8-5-3(9)1-2-4(6(5)10)12-7(11)13/h1-2H,(H3,11,12,13) |
| InChIKey | DMFNLCFZVBLWAE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.01 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|