About methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate
methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate (PubChem CID 169361257) has the molecular formula C13H16Cl2N4S
and a molecular weight of 331.27 g/mol. Its IUPAC name is methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate |
| PubChem CID | 169361257 |
| Molecular Formula | C13H16Cl2N4S |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cc(Cl)c(Cl)cc1NCC(C)C)NC#N |
| InChI | InChI=1S/C13H16Cl2N4S/c1-8(2)6-17-11-4-9(14)10(15)5-12(11)19-13(20-3)18-7-16/h4-5,8,17H,6H2,1-3H3,(H,18,19) |
| InChIKey | ZXZSIKLCWCGKTJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate?
The IUPAC name of methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate (CID 169361257) is methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate.
What is the SMILES notation for methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate?
The canonical SMILES for methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate is CS/C(=N\c1cc(Cl)c(Cl)cc1NCC(C)C)NC#N.
What is the InChIKey of methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate?
The InChIKey is ZXZSIKLCWCGKTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2N4S/c1-8(2)6-17-11-4-9(14)10(15)5-12(11)19-13(20-3)18-7-16/h4-5,8,17H,6H2,1-3H3,(H,18,19).
What are the key properties of methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate?
methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate has a molecular weight of 331.27 g/mol, XLogP of 4.48, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate is sourced from PubChem (CID 169361257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).