C13H16Cl2N4S — CID 169361257
methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate (PubChem CID 169361257) has the molecular formula C13H16Cl2N4S and a molecular weight of 331.27 g/mol. Its IUPAC name is methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169361257 |
| Molecular Formula | C13H16Cl2N4S |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | methyl N-cyano-N'-[4,5-dichloro-2-(2-methylpropylamino)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cc(Cl)c(Cl)cc1NCC(C)C)NC#N |
| InChI | InChI=1S/C13H16Cl2N4S/c1-8(2)6-17-11-4-9(14)10(15)5-12(11)19-13(20-3)18-7-16/h4-5,8,17H,6H2,1-3H3,(H,18,19) |
| InChIKey | ZXZSIKLCWCGKTJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|