C14H18N4S — CID 169364319
methyl N-cyano-N'-(4-piperidin-3-ylphenyl)carbamimidothioate (PubChem CID 169364319) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is methyl N-cyano-N'-(4-piperidin-3-ylphenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(4-piperidin-3-ylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 169364319 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | methyl N-cyano-N'-(4-piperidin-3-ylphenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1ccc(C2CCCNC2)cc1)NC#N |
| InChI | InChI=1S/C14H18N4S/c1-19-14(17-10-15)18-13-6-4-11(5-7-13)12-3-2-8-16-9-12/h4-7,12,16H,2-3,8-9H2,1H3,(H,17,18) |
| InChIKey | CZDUXZJOJWVQBG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|