C12H15ClN2 — CID 169366117
2-chloro-N'-(6-methyl-2,3-dihydro-1H-inden-4-yl)ethanimidamide (PubChem CID 169366117) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 2-chloro-N'-(6-methyl-2,3-dihydro-1H-inden-4-yl)ethanimidamide.
| Compound Name | 2-chloro-N'-(6-methyl-2,3-dihydro-1H-inden-4-yl)ethanimidamide |
|---|---|
| PubChem CID | 169366117 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-chloro-N'-(6-methyl-2,3-dihydro-1H-inden-4-yl)ethanimidamide |
| SMILES | Cc1cc2c(c(/N=C(/N)CCl)c1)CCC2 |
| InChI | InChI=1S/C12H15ClN2/c1-8-5-9-3-2-4-10(9)11(6-8)15-12(14)7-13/h5-6H,2-4,7H2,1H3,(H2,14,15) |
| InChIKey | DOYPPDHERDTSBM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|