C22H26Cl2N4O2 — CID 169366671
2-chloro-N'-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]ethanimidamide (PubChem CID 169366671) has the molecular formula C22H26Cl2N4O2 and a molecular weight of 449.38 g/mol. Its IUPAC name is 2-chloro-N'-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366671 |
| Molecular Formula | C22H26Cl2N4O2 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2-chloro-N'-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]ethanimidamide |
| SMILES | CCCOc1ccc(C(=O)N2CCN(c3ccc(/N=C(/N)CCl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H26Cl2N4O2/c1-2-13-30-18-6-3-16(4-7-18)22(29)28-11-9-27(10-12-28)20-8-5-17(14-19(20)24)26-21(25)15-23/h3-8,14H,2,9-13,15H2,1H3,(H2,25,26) |
| InChIKey | BDVCXBCZQMQRLI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|