C13H19ClN4O2S — CID 169367341
2-chloro-N'-[2-(4-methylpiperazin-1-yl)sulfonylphenyl]ethanimidamide (PubChem CID 169367341) has the molecular formula C13H19ClN4O2S and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-chloro-N'-[2-(4-methylpiperazin-1-yl)sulfonylphenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2-(4-methylpiperazin-1-yl)sulfonylphenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367341 |
| Molecular Formula | C13H19ClN4O2S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-chloro-N'-[2-(4-methylpiperazin-1-yl)sulfonylphenyl]ethanimidamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccccc2/N=C(/N)CCl)CC1 |
| InChI | InChI=1S/C13H19ClN4O2S/c1-17-6-8-18(9-7-17)21(19,20)12-5-3-2-4-11(12)16-13(15)10-14/h2-5H,6-10H2,1H3,(H2,15,16) |
| InChIKey | PHCJXNBVPKGYDR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|