C16H25ClN2O2S — CID 175326438
1-[2-(5-chloropentyl)phenyl]sulfonyl-4-methylpiperazine (PubChem CID 175326438) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is 1-[2-(5-chloropentyl)phenyl]sulfonyl-4-methylpiperazine.
| Compound Name | 1-[2-(5-chloropentyl)phenyl]sulfonyl-4-methylpiperazine |
|---|---|
| PubChem CID | 175326438 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[2-(5-chloropentyl)phenyl]sulfonyl-4-methylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2ccccc2CCCCCCl)CC1 |
| InChI | InChI=1S/C16H25ClN2O2S/c1-18-11-13-19(14-12-18)22(20,21)16-9-5-4-8-15(16)7-3-2-6-10-17/h4-5,8-9H,2-3,6-7,10-14H2,1H3 |
| InChIKey | DMAISXQFBDANDB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|