C22H26N6OS — CID 169377182
[7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-thiophen-2-ylmethanone (PubChem CID 169377182) has the molecular formula C22H26N6OS and a molecular weight of 422.56 g/mol. Its IUPAC name is [7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-thiophen-2-ylmethanone.
| Compound Name | [7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 169377182 |
| Molecular Formula | C22H26N6OS |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-thiophen-2-ylmethanone |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc3c(c2)CN(C(=O)c2cccs2)CC3)C(N)=N1 |
| InChI | InChI=1S/C22H26N6OS/c23-20-25-21(24)28(22(26-20)9-2-1-3-10-22)17-7-6-15-8-11-27(14-16(15)13-17)19(29)18-5-4-12-30-18/h4-7,12-13H,1-3,8-11,14H2,(H4,23,24,25,26) |
| InChIKey | SKHVEUISHWRFPA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |