C19H17N9O2 — CID 169381442
[5,7-diamino-6-cyano-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169381442) has the molecular formula C19H17N9O2 and a molecular weight of 403.41 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169381442 |
| Molecular Formula | C19H17N9O2 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [5,7-diamino-6-cyano-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CCN1C(=O)COc2ccc(C3N=C(NC#N)Nc4nc(N)c(C#N)c(N)c43)cc21 |
| InChI | InChI=1S/C19H17N9O2/c1-2-28-11-5-9(3-4-12(11)30-7-13(28)29)16-14-15(22)10(6-20)17(23)26-18(14)27-19(25-16)24-8-21/h3-5,16H,2,7H2,1H3,(H6,22,23,24,25,26,27) |
| InChIKey | NATAYMINVCGULE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 178.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|