C17H6F10N4O — CID 169395448
2-amino-4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169395448) has the molecular formula C17H6F10N4O and a molecular weight of 472.24 g/mol. Its IUPAC name is 2-amino-4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169395448 |
| Molecular Formula | C17H6F10N4O |
| Molecular Weight | 472.24 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 2-amino-4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-4-(trifluoromethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccc(C(F)(F)F)c(C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H6F10N4O/c18-14(19,16(23,24)17(25,26)27)10-3-6(1-2-9(10)15(20,21)22)11-7(4-28)12(30)31-13(32)8(11)5-29/h1-3H,(H3,30,31,32) |
| InChIKey | KDNHCYJYXUTDCY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|