About [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid
[5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid (PubChem CID 169395464) has the molecular formula C14H8BF3N4O4
and a molecular weight of 364.05 g/mol. Its IUPAC name is [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid.
Molecular Properties
| Compound Name | [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid |
| PubChem CID | 169395464 |
| Molecular Formula | C14H8BF3N4O4 |
| Molecular Weight | 364.05 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccc(OC(F)(F)F)c(B(O)O)c1 |
| InChI | InChI=1S/C14H8BF3N4O4/c16-14(17,18)26-10-2-1-6(3-9(10)15(24)25)11-7(4-19)12(21)22-13(23)8(11)5-20/h1-3,24-25H,(H3,21,22,23) |
| InChIKey | DLUOFULHFFAJFP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.05 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid?
The IUPAC name of [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid (CID 169395464) is [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid.
What is the SMILES notation for [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid?
The canonical SMILES for [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid is N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccc(OC(F)(F)F)c(B(O)O)c1.
What is the InChIKey of [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid?
The InChIKey is DLUOFULHFFAJFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BF3N4O4/c16-14(17,18)26-10-2-1-6(3-9(10)15(24)25)11-7(4-19)12(21)22-13(23)8(11)5-20/h1-3,24-25H,(H3,21,22,23).
What are the key properties of [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid?
[5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid has a molecular weight of 364.05 g/mol, XLogP of -0.05, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid is sourced from PubChem (CID 169395464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).