C14H8BF3N4O4 — CID 169395464
[5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid (PubChem CID 169395464) has the molecular formula C14H8BF3N4O4 and a molecular weight of 364.05 g/mol. Its IUPAC name is [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid.
| Compound Name | [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 169395464 |
| Molecular Formula | C14H8BF3N4O4 |
| Molecular Weight | 364.05 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [5-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-(trifluoromethoxy)phenyl]boronic acid |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccc(OC(F)(F)F)c(B(O)O)c1 |
| InChI | InChI=1S/C14H8BF3N4O4/c16-14(17,18)26-10-2-1-6(3-9(10)15(24)25)11-7(4-19)12(21)22-13(23)8(11)5-20/h1-3,24-25H,(H3,21,22,23) |
| InChIKey | DLUOFULHFFAJFP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.05 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|