C13H8FN5 — CID 169398430
2,4-diamino-6-(2-ethynyl-6-fluorophenyl)pyrimidine-5-carbonitrile (PubChem CID 169398430) has the molecular formula C13H8FN5 and a molecular weight of 253.24 g/mol. Its IUPAC name is 2,4-diamino-6-(2-ethynyl-6-fluorophenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(2-ethynyl-6-fluorophenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398430 |
| Molecular Formula | C13H8FN5 |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2,4-diamino-6-(2-ethynyl-6-fluorophenyl)pyrimidine-5-carbonitrile |
| SMILES | C#Cc1cccc(F)c1-c1nc(N)nc(N)c1C#N |
| InChI | InChI=1S/C13H8FN5/c1-2-7-4-3-5-9(14)10(7)11-8(6-15)12(16)19-13(17)18-11/h1,3-5H,(H4,16,17,18,19) |
| InChIKey | QDIOXBSXJUHQLH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|