About ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate
ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate (PubChem CID 169400692) has the molecular formula C19H27N5O2
and a molecular weight of 357.46 g/mol. Its IUPAC name is ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate |
| PubChem CID | 169400692 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(CN2CCN(C)CC2)c(C)cc1C |
| InChI | InChI=1S/C19H27N5O2/c1-5-26-19(25)18-17(20-22-21-18)16-11-15(13(2)10-14(16)3)12-24-8-6-23(4)7-9-24/h10-11H,5-9,12H2,1-4H3,(H,20,21,22) |
| InChIKey | COLCPLUUZFSNEQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate?
The IUPAC name of ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate (CID 169400692) is ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate?
The canonical SMILES for ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate is CCOC(=O)c1n[nH]nc1-c1cc(CN2CCN(C)CC2)c(C)cc1C.
What is the InChIKey of ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate?
The InChIKey is COLCPLUUZFSNEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N5O2/c1-5-26-19(25)18-17(20-22-21-18)16-11-15(13(2)10-14(16)3)12-24-8-6-23(4)7-9-24/h10-11H,5-9,12H2,1-4H3,(H,20,21,22).
What are the key properties of ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate?
ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate has a molecular weight of 357.46 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[2,4-dimethyl-5-[(4-methylpiperazin-1-yl)methyl]phenyl]-2H-triazole-4-carboxylate is sourced from PubChem (CID 169400692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).