C14H15N5O2 — CID 169401283
ethyl 5-(2,3-dimethylindazol-6-yl)-2H-triazole-4-carboxylate (PubChem CID 169401283) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is ethyl 5-(2,3-dimethylindazol-6-yl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2,3-dimethylindazol-6-yl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401283 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | ethyl 5-(2,3-dimethylindazol-6-yl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc2c(C)n(C)nc2c1 |
| InChI | InChI=1S/C14H15N5O2/c1-4-21-14(20)13-12(15-18-16-13)9-5-6-10-8(2)19(3)17-11(10)7-9/h5-7H,4H2,1-3H3,(H,15,16,18) |
| InChIKey | PFNDFJXMXIUNDQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |