About 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid
2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405672) has the molecular formula C22H29N3O5
and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| PubChem CID | 169405672 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC(C)CN(Cc1cccc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)c1)CC(C)C |
| InChI | InChI=1S/C22H29N3O5/c1-12(2)9-25(10-13(3)4)11-14-6-5-7-15(8-14)16-17(21(27)28)19(23)24-20(26)18(16)22(29)30/h5-8,12-13H,9-11H2,1-4H3,(H,27,28)(H,29,30)(H3,23,24,26) |
| InChIKey | QZEINWSJERUHOB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The IUPAC name of 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (CID 169405672) is 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The canonical SMILES for 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid is CC(C)CN(Cc1cccc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)c1)CC(C)C.
What is the InChIKey of 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The InChIKey is QZEINWSJERUHOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O5/c1-12(2)9-25(10-13(3)4)11-14-6-5-7-15(8-14)16-17(21(27)28)19(23)24-20(26)18(16)22(29)30/h5-8,12-13H,9-11H2,1-4H3,(H,27,28)(H,29,30)(H3,23,24,26).
What are the key properties of 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid has a molecular weight of 415.49 g/mol, XLogP of 3.13, 9 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[3-[[bis(2-methylpropyl)amino]methyl]phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 169405672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).