C14H8N4O — CID 169409416
2-(1,10-phenanthrolin-2-yl)-1,3,4-oxadiazole (PubChem CID 169409416) has the molecular formula C14H8N4O and a molecular weight of 248.25 g/mol. Its IUPAC name is 2-(1,10-phenanthrolin-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(1,10-phenanthrolin-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 169409416 |
| Molecular Formula | C14H8N4O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-(1,10-phenanthrolin-2-yl)-1,3,4-oxadiazole |
| SMILES | c1cnc2c(c1)ccc1ccc(-c3nnco3)nc12 |
| InChI | InChI=1S/C14H8N4O/c1-2-9-3-4-10-5-6-11(14-18-16-8-19-14)17-13(10)12(9)15-7-1/h1-8H |
| InChIKey | KHEWJUCBJNTJQW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|