C18H13ClN4O2 — CID 169410239
4-amino-1-(2-chloro-3-pyridinyl)-5-(4-methoxybenzoyl)pyrrole-3-carbonitrile (PubChem CID 169410239) has the molecular formula C18H13ClN4O2 and a molecular weight of 352.78 g/mol. Its IUPAC name is 4-amino-1-(2-chloro-3-pyridinyl)-5-(4-methoxybenzoyl)pyrrole-3-carbonitrile.
| Compound Name | 4-amino-1-(2-chloro-3-pyridinyl)-5-(4-methoxybenzoyl)pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 169410239 |
| Molecular Formula | C18H13ClN4O2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 4-amino-1-(2-chloro-3-pyridinyl)-5-(4-methoxybenzoyl)pyrrole-3-carbonitrile |
| SMILES | COc1ccc(C(=O)c2c(N)c(C#N)cn2-c2cccnc2Cl)cc1 |
| InChI | InChI=1S/C18H13ClN4O2/c1-25-13-6-4-11(5-7-13)17(24)16-15(21)12(9-20)10-23(16)14-3-2-8-22-18(14)19/h2-8,10H,21H2,1H3 |
| InChIKey | VUSPEZKLJJIQHM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|