C20H23F2N3O2S — CID 169410644
[(4aR,8aR)-4a-(hydroxymethyl)-1-(1,3-thiazol-5-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(2,3-difluorophenyl)methanone (PubChem CID 169410644) has the molecular formula C20H23F2N3O2S and a molecular weight of 407.49 g/mol. Its IUPAC name is [(4aR,8aR)-4a-(hydroxymethyl)-1-(1,3-thiazol-5-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(2,3-difluorophenyl)methanone.
| Compound Name | [(4aR,8aR)-4a-(hydroxymethyl)-1-(1,3-thiazol-5-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(2,3-difluorophenyl)methanone |
|---|---|
| PubChem CID | 169410644 |
| Molecular Formula | C20H23F2N3O2S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [(4aR,8aR)-4a-(hydroxymethyl)-1-(1,3-thiazol-5-ylmethyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(2,3-difluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1F)N1CC[C@]2(CO)CCCN(Cc3cncs3)[C@H]2C1 |
| InChI | InChI=1S/C20H23F2N3O2S/c21-16-4-1-3-15(18(16)22)19(27)25-8-6-20(12-26)5-2-7-24(17(20)11-25)10-14-9-23-13-28-14/h1,3-4,9,13,17,26H,2,5-8,10-12H2/t17-,20-/m0/s1 |
| InChIKey | SDNYEUONLLARJZ-PXNSSMCTSA-N |
| XLogP | 2.91 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |