C19H20N4O2 — CID 169413087
9-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-1,6,8,9-tetrahydropyrazolo[5,4-f]quinolin-7-one (PubChem CID 169413087) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 9-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-1,6,8,9-tetrahydropyrazolo[5,4-f]quinolin-7-one.
| Compound Name | 9-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-1,6,8,9-tetrahydropyrazolo[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 169413087 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 9-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-1,6,8,9-tetrahydropyrazolo[5,4-f]quinolin-7-one |
| SMILES | CN(C)Cc1cc(C2CC(=O)Nc3ccc4cn[nH]c4c32)ccc1O |
| InChI | InChI=1S/C19H20N4O2/c1-23(2)10-13-7-11(4-6-16(13)24)14-8-17(25)21-15-5-3-12-9-20-22-19(12)18(14)15/h3-7,9,14,24H,8,10H2,1-2H3,(H,20,22)(H,21,25) |
| InChIKey | QYCLIVDHXYXSGG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|